4-Bromo-2-methylbenzoic acid
- Product Name4-Bromo-2-methylbenzoic acid
- CAS68837-59-2
- MFC8H7BrO2
- MW215.04
- EINECS272-437-7
- MOL File68837-59-2.mol
Chemical Properties
| Melting point | 180-184 °C |
| Boiling point | 310.1±30.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.63±0.25(Predicted) |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2249816 |
| InChI | InChI=1S/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | RVCJOGNLYVNRDN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1C |
| CAS DataBase Reference | 68837-59-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163990 |
