| Boiling point |
216-217 °C(lit.) |
| Density |
1.004 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.4609(lit.) |
| Flash point |
221 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
clear liquid |
| pka |
14.13±0.20(Predicted) |
| Specific Gravity |
1.001.004 |
| color |
Colorless to Light yellow |
| Stability |
Stable. Incompatible with oxidizing agents, acids. |
| InChI |
InChI=1S/C5H13NO2/c1-6(2)3-5(8)4-7/h5,7-8H,3-4H2,1-2H3 |
| InChIKey |
QCMHUGYTOGXZIW-UHFFFAOYSA-N |
| SMILES |
C(O)C(O)CN(C)C |
| CAS DataBase Reference |
623-57-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2-Propanediol, 3-(dimethylamino)-(623-57-4) |
| EPA Substance Registry System |
1,2-Propanediol, 3-(dimethylamino)- (623-57-4) |
