3-Hydroxy-1,8-naphthalic anhydride
- Product Name3-Hydroxy-1,8-naphthalic anhydride
- CAS23204-36-6
- MFC12H6O4
- MW214.17
- EINECS
- MOL File23204-36-6.mol
Chemical Properties
| Melting point | 281 °C |
| Boiling point | 509.4±33.0 °C(Predicted) |
| Density | 1.585±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 7.93±0.20(Predicted) |
| color | Light yellow to Yellow |
| InChI | InChI=1S/C12H6O4/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5,13H |
| InChIKey | FKVNZFAMXGMPOU-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC(O)=CC3=C2C1=CC=C3 |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2917.39.7000 |
| HazardClass | IRRITANT |
