| Melting point |
76-78 °C (lit.) |
| Boiling point |
275.56°C (rough estimate) |
| Density |
1.2481 (rough estimate) |
| refractive index |
1.4500 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
3.97±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| BRN |
2097993 |
| InChI |
InChI=1S/C9H10O4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey |
NYJBTJMNTNCTCP-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC(OC)=CC=C1OC |
| LogP |
1.281 (est) |
| CAS DataBase Reference |
2785-98-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzoic acid, 2,5-dimethoxy-(2785-98-0) |
