2942-42-9
Name | 7-Nitroindazole |
CAS | 2942-42-9 |
EINECS(EC#) | 220-934-4 |
Molecular Formula | C7H5N3O2 |
MDL Number | MFCD00022789 |
Molecular Weight | 163.13 |
MOL File | 2942-42-9.mol |
Chemical Properties
Appearance | yellow powder |
Melting point | 185-186°C |
Boiling point | 290.19°C (rough estimate) |
density | 1.4141 (rough estimate) |
refractive index | 1.5500 (estimate) |
storage temp. | −20°C |
solubility | Soluble to 100 mM in DMSO and to 20 mM in ethanol |
form | powder to crystal |
pka | 10.03±0.40(Predicted) |
color | Light yellow to Brown |
Water Solubility | slightly soluble |
Usage | A potent, selective brain inhibitor of mouse cerebellar Nitric Oxide Synthase. |
BRN | 6809 |
InChI | InChI=1S/C7H5N3O2/c11-10(12)6-3-1-2-5-4-8-9-7(5)6/h1-4H,(H,8,9) |
InChIKey | PQCAUHUKTBHUSA-UHFFFAOYSA-N |
SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C=N1 |
CAS DataBase Reference | 2942-42-9(CAS DataBase Reference) |
NIST Chemistry Reference | 7-Nitroindazole(2942-42-9) |
Safety Data
Hazard Codes | T |
Risk Statements | |
Safety Statements | |
RIDADR | UN 2811 6.1/PG 3 |
WGK Germany | 3 |
RTECS | NK7962200 |
HazardClass | IRRITANT |
PackingGroup | Ⅲ |
HS Code | 29339900 |