3-Amino-4-methylbenzonitrile
- Product Name3-Amino-4-methylbenzonitrile
- CAS60710-80-7
- CBNumberCB4257974
- MFC8H8N2
- MW132.16
- MDL NumberMFCD04039781
- MOL File60710-80-7.mol
Chemical Properties
| Melting point | 81 °C |
| Boiling point | 312.8±22.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2?+-.0.10(Predicted) |
| form | crystals |
| color | White to off white to clear shards |
| InChI | InChI=1S/C8H8N2/c1-6-2-3-7(5-9)4-8(6)10/h2-4H,10H2,1H3 |
| InChIKey | IEWMNQUBZPVSSV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C)C(N)=C1 |
| CAS DataBase Reference | 60710-80-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| Hazard Codes | T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3276 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
