Cefpodoxime proxetil
- Product NameCefpodoxime proxetil
- CAS87239-81-4
- CBNumberCB5150483
- MFC21H27N5O9S2
- MW557.6
- EINECS1308068-626-2
- MDL NumberMFCD00865088
- MOL File87239-81-4.mol
- MSDS FileSDS
Chemical Properties
Melting point | 111-113°C |
Density | 1.58±0.1 g/cm3(Predicted) |
RTECS | XI0367370 |
storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
solubility | Soluble in DMSO |
pka | 8.13±0.60(Predicted) |
color | White to Pale Yellow |
Sensitive | Light Sensitive |
InChIKey | LTINZAODLRIQIX-FBXRGJNPSA-N |
SMILES | N12[C@@]([H])([C@H](NC(/C(/C3=CSC(N)=N3)=N\OC)=O)C1=O)SCC(COC)=C2C(OC(OC(OC(C)C)=O)C)=O |
CAS DataBase Reference | 87239-81-4(CAS DataBase Reference) |
FDA UNII | 2TB00A1Z7N |
NCI Drug Dictionary | cefpodoxime proxetil |
Safety
Symbol(GHS) | |
Signal word | Warning |
Hazard statements | H317-H334 |
Precautionary statements | P261-P280g-P284-P304+P340-P342+P311a-P501a |
Hazard Codes | Xi |
Risk Statements | 36/37/38-42/43 |
Safety Statements | 22-26-36/37/39 |
WGK Germany | 3 |
HS Code | 30042000 |
Toxicity | LD50 in male, female mice, male, female rats (mg/kg): >10000, >10000, >2000, >2000 s.c., 3502, 2535, >4000, >4000 i.p.; >8000, >8000, >4000, >4000 orally (Nakao, 1988) |
Preparation Products And Raw materials
Cefpodoxime proxetil Supplier
Global(389)Suppliers
Supplier | Tel | Country | ProdList | Advantage | |
---|---|---|---|---|---|
+86-0371-55170693 +86-19937530512 |
info@tianfuchem.com | China | 21691 | 55 | |
+86-0371-86658258 | sales@coreychem.com | China | 29914 | 58 | |
0086-13720134139 | candy@biochempartner.com | CHINA | 967 | 58 | |
18631714998 | sales@czwytech.com | CHINA | 906 | 58 | |
+86-592-6051114 +8618959220845 |
sales@amoychem.com | China | 6387 | 58 | |
18627774460 | faith@widelychemical.com | CHINA | 742 | 58 | |
+86-023-61398051 +8613650506873 |
sales@chemdad.com | China | 39916 | 58 | |
+8618523575427 | sales@conier.com | China | 49390 | 58 | |
+8617531190177 | peter@yan-xi.com | China | 5993 | 58 | |
15369953316 +8615369953316 |
admin@zhanyaobio.com | China | 2136 | 58 | |
+8615255079626 | eric@witopchemical.com | China | 23556 | 58 | |
+86-029-89586680 +86-18192503167 |
1026@dideu.com | China | 9320 | 58 | |
+86-29-89586680 +86-15129568250 |
1026@dideu.com | China | 29220 | 58 | |
0571-85134551 | info@afinechem.com | CHINA | 15377 | 58 | |
+86-27-59207850 +86-13986145403 |
info@fortunachem.com | China | 5988 | 58 | |
+8615604608665 15604608665 |
dominicguo@gk-bio.com | CHINA | 9427 | 58 | |
571-88938639 +8617705817739 |
info@dycnchem.com | CHINA | 52867 | 58 | |
+1-2135480471 +1-2135480471 |
sales@sarms4muscle.com | China | 10523 | 58 | |
+8615250961469 | 2571773637@qq.com | China | 9821 | 58 | |
+8617013299288 | dj@sgtlifesciences.com | China | 12382 | 58 | |
0551-65418684 +8618949823763 |
sales@tnjchem.com | China | 25363 | 58 | |
+8618032673083 | sales05@hbduling.cn | China | 15745 | 58 | |
+86-25-58227606 +86-15305155328 |
sales@dogechemical.com | China | 4128 | 58 | |
+86-852-30606658 | market18@leapchem.com | China | 24738 | 58 | |
+86-85511178 +86-85511178 |
peter68@ptchemgroup.com | China | 35453 | 58 | |
+86-0576225566889 +86-13454675544 |
admin@jiuzhou-chem.com;jamie@jiuzhou-chem.com;alice@jiuzhou-chem.com | China | 20000 | 58 | |
+8613340353813 | info@hanpets.com | China | 26 | 58 | |
+86-0755-26050679 +86-15915472436 |
sale@ex-biotech.cn | China | 1031 | 58 | |
+8618327326525 | masar@topule.com | China | 8474 | 58 | |
+undefined18621343501 | product@acmec-e.com | China | 33349 | 58 | |
571-89925085 | sales@amadischem.com | China | 131981 | 58 | |
+86-0592-6210733 | sale@mainchem.com | China | 32360 | 55 | |
+86-020-81716320 +86-13602409664 |
Sales@pipitech.com | China | 3635 | 55 | |
86-21-51086038 | chemwill_asia@126.com | CHINA | 23931 | 58 | |
400-880-2824 18107960669 |
bd@ruiweier.cn | China | 1010 | 58 | |
010-82848833 400-666-7788 |
jkinfo@jkchemical.com | China | 96815 | 76 | |
821-50328103-801 18930552037 |
3bsc@sina.com | China | 15848 | 69 | |
021-50135380 | shchemsky@sina.com | China | 32344 | 50 | |
0712-0712-2580635 15527768850 |
1791901229@qq.com | China | 8849 | 52 | |
13355009207 13355009207 |
3007715519@qq.com | China | 18739 | 57 | |
86-21-63210123 | sj_scrc@sinopharm.com | China | 9823 | 79 | |
0731-85526065 13308475853 |
ivy@hnhbsj.com | China | 4550 | 62 | |
027-027-59207852 13308628970 |
buy@fortunachem.com | China | 2893 | 58 | |
0411-62910999 13889544652 |
sales@meilune.com | China | 4647 | 58 | |
010-56205725 | waley188@sohu.com | China | 12338 | 58 | |
+86 21 61551611 | China | 9901 | 58 | ||
025-57798810 | sales@sunlidabio.com | China | 3750 | 55 | |
021-33632979 15002134094 |
marketing@targetmol.com | China | 7934 | 58 | |
27-81302488 18007166089 |
info@dkybpc.com | China | 2024 | 58 | |
0755-66853366 13670046396 |
sales@chem-strong.com | China | 17982 | 56 |