2,7-Diaminofluorene
- Product Name2,7-Diaminofluorene
- CAS525-64-4
- MFC13H12N2
- MW196.25
- EINECS208-377-5
- MOL File525-64-4.mol
Chemical Properties
| Melting point | 160-162 °C (lit.) |
| Boiling point | 323.14°C (rough estimate) |
| Density | 1.1265 (rough estimate) |
| refractive index | 1.5014 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystaline |
| pka | 4.63±0.20(Predicted) |
| color | White to Gray to Brown |
| Water Solubility | Slightly soluble in cold water. Soluble in hot water. Sparingly soluble in ethanol. and acetone. Insoluble in ether. |
| Merck | 14,4156 |
| BRN | 2099859 |
| InChI | InChI=1S/C13H12N2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,14-15H2 |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2 |
| CAS DataBase Reference | 525-64-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | LL6980000 |
| HS Code | 2921.51.5000 |
